C23H44O — CID 134931012
(2S,6S)-2,6-di(nonyl)-3,6-dihydro-2H-pyran (PubChem CID 134931012) has the molecular formula C23H44O and a molecular weight of 336.60 g/mol. Its IUPAC name is (2S,6S)-2,6-di(nonyl)-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-2,6-di(nonyl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 134931012 |
| Molecular Formula | C23H44O |
| Molecular Weight | 336.60 g/mol |
| Exact Mass | 336.34 |
| IUPAC Name | (2S,6S)-2,6-di(nonyl)-3,6-dihydro-2H-pyran |
| SMILES | CCCCCCCCC[C@H]1CC=C[C@H](CCCCCCCCC)O1 |
| InChI | InChI=1S/C23H44O/c1-3-5-7-9-11-13-15-18-22-20-17-21-23(24-22)19-16-14-12-10-8-6-4-2/h17,20,22-23H,3-16,18-19,21H2,1-2H3/t22-,23-/m0/s1 |
| InChIKey | FYTZOAIGWIHKGW-GOTSBHOMSA-N |
| XLogP | 7.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.60 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|