C21H28O4 — CID 134931069
ethyl (2R,3R,6R)-2-benzyl-6-cyclohexyl-4-oxooxane-3-carboxylate (PubChem CID 134931069) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is ethyl (2R,3R,6R)-2-benzyl-6-cyclohexyl-4-oxooxane-3-carboxylate.
| Compound Name | ethyl (2R,3R,6R)-2-benzyl-6-cyclohexyl-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 134931069 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | ethyl (2R,3R,6R)-2-benzyl-6-cyclohexyl-4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C[C@H](C2CCCCC2)O[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C21H28O4/c1-2-24-21(23)20-17(22)14-18(16-11-7-4-8-12-16)25-19(20)13-15-9-5-3-6-10-15/h3,5-6,9-10,16,18-20H,2,4,7-8,11-14H2,1H3/t18-,19-,20+/m1/s1 |
| InChIKey | YRMALBXHEXYTFC-AQNXPRMDSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|