C28H22O5 — CID 134931148
methyl (15R)-15-[(1S,4S,5S)-2-oxo-4-phenyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate (PubChem CID 134931148) has the molecular formula C28H22O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is methyl (15R)-15-[(1S,4S,5S)-2-oxo-4-phenyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate.
| Compound Name | methyl (15R)-15-[(1S,4S,5S)-2-oxo-4-phenyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
|---|---|
| PubChem CID | 134931148 |
| Molecular Formula | C28H22O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | methyl (15R)-15-[(1S,4S,5S)-2-oxo-4-phenyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carboxylate |
| SMILES | COC(=O)[C@]1([C@]23O[C@H]2[C@H](c2ccccc2)OC3=O)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C28H22O5/c1-31-25(29)27(28-24(33-28)23(32-26(28)30)16-9-3-2-4-10-16)15-21-17-11-5-7-13-19(17)22(27)20-14-8-6-12-18(20)21/h2-14,21-24H,15H2,1H3/t21?,22?,23-,24-,27-,28-/m0/s1 |
| InChIKey | OEFCUKQYLQVPOY-YEFWSLMBSA-N |
| XLogP | 4.26 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|