C13H18O2S — CID 134931204
(2R,5R)-2-methyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]oxolane (PubChem CID 134931204) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (2R,5R)-2-methyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]oxolane.
| Compound Name | (2R,5R)-2-methyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]oxolane |
|---|---|
| PubChem CID | 134931204 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2R,5R)-2-methyl-5-[[(S)-(4-methylphenyl)sulfinyl]methyl]oxolane |
| SMILES | Cc1ccc([S@@](=O)C[C@H]2CC[C@@H](C)O2)cc1 |
| InChI | InChI=1S/C13H18O2S/c1-10-3-7-13(8-4-10)16(14)9-12-6-5-11(2)15-12/h3-4,7-8,11-12H,5-6,9H2,1-2H3/t11-,12-,16+/m1/s1 |
| InChIKey | JQPDWTJVULQTDT-HSMVNMDESA-N |
| XLogP | 2.67 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |