About [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate
[(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate (PubChem CID 134931229) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate |
| PubChem CID | 134931229 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate |
| SMILES | CCO[C@@H]1C[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H18O3/c1-5-12-7-6-8(7)13-9(11)10(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1 |
| InChIKey | MMXDXSDEFVDKSS-SFYZADRCSA-N |
| XLogP | 1.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate?
The IUPAC name of [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate (CID 134931229) is [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate?
The canonical SMILES for [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate is CCO[C@@H]1C[C@@H]1OC(=O)C(C)(C)C.
What is the InChIKey of [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate?
The InChIKey is MMXDXSDEFVDKSS-SFYZADRCSA-N. The full InChI is InChI=1S/C10H18O3/c1-5-12-7-6-8(7)13-9(11)10(2,3)4/h7-8H,5-6H2,1-4H3/t7-,8+/m1/s1.
What are the key properties of [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate?
[(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate has a molecular weight of 186.25 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-ethoxycyclopropyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 134931229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).