C26H42O5 — CID 134931254
methyl (1R,4aR,8aS,9S)-9-(2-ethoxy-2-oxoethyl)-9-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8a,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 134931254) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl (1R,4aR,8aS,9S)-9-(2-ethoxy-2-oxoethyl)-9-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8a,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aR,8aS,9S)-9-(2-ethoxy-2-oxoethyl)-9-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8a,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 134931254 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl (1R,4aR,8aS,9S)-9-(2-ethoxy-2-oxoethyl)-9-methoxy-1,4a-dimethyl-7-propan-2-yl-3,4,4b,5,6,8a,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | CCOC(=O)C[C@@]1(OC)CC2[C@](C)(CCC[C@@]2(C)C(=O)OC)C2CCC(C(C)C)=C[C@@H]21 |
| InChI | InChI=1S/C26H42O5/c1-8-31-22(27)16-26(30-7)15-21-24(4,12-9-13-25(21,5)23(28)29-6)19-11-10-18(17(2)3)14-20(19)26/h14,17,19-21H,8-13,15-16H2,1-7H3/t19?,20-,21?,24+,25+,26-/m0/s1 |
| InChIKey | KVSHWQYXIAKBCW-ALVWNEIFSA-N |
| XLogP | 5.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|