C37H50O7 — CID 134931290
(1S,3R,5S,7R,8S,10R,12S,14R,15R,17S,22R)-5,14,22-trimethyl-8-phenylmethoxy-7-(phenylmethoxymethyl)-2,6,11,16,21-pentaoxapentacyclo[13.9.0.03,12.05,10.017,22]tetracosane (PubChem CID 134931290) has the molecular formula C37H50O7 and a molecular weight of 606.80 g/mol. Its IUPAC name is (1S,3R,5S,7R,8S,10R,12S,14R,15R,17S,22R)-5,14,22-trimethyl-8-phenylmethoxy-7-(phenylmethoxymethyl)-2,6,11,16,21-pentaoxapentacyclo[13.9.0.03,12.05,10.017,22]tetracosane.
| Compound Name | (1S,3R,5S,7R,8S,10R,12S,14R,15R,17S,22R)-5,14,22-trimethyl-8-phenylmethoxy-7-(phenylmethoxymethyl)-2,6,11,16,21-pentaoxapentacyclo[13.9.0.03,12.05,10.017,22]tetracosane |
|---|---|
| PubChem CID | 134931290 |
| Molecular Formula | C37H50O7 |
| Molecular Weight | 606.80 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | (1S,3R,5S,7R,8S,10R,12S,14R,15R,17S,22R)-5,14,22-trimethyl-8-phenylmethoxy-7-(phenylmethoxymethyl)-2,6,11,16,21-pentaoxapentacyclo[13.9.0.03,12.05,10.017,22]tetracosane |
| SMILES | C[C@@H]1C[C@@H]2O[C@@H]3C[C@H](OCc4ccccc4)[C@@H](COCc4ccccc4)O[C@@]3(C)C[C@H]2O[C@H]2CC[C@@]3(C)OCCC[C@@H]3O[C@H]12 |
| InChI | InChI=1S/C37H50O7/c1-25-19-30-31(41-28-16-17-36(2)33(43-35(25)28)15-10-18-40-36)21-37(3)34(42-30)20-29(39-23-27-13-8-5-9-14-27)32(44-37)24-38-22-26-11-6-4-7-12-26/h4-9,11-14,25,28-35H,10,15-24H2,1-3H3/t25-,28+,29+,30+,31-,32-,33+,34-,35-,36-,37+/m1/s1 |
| InChIKey | XFUIYZBJDNJQKL-VBCKHQLLSA-N |
| XLogP | 6.40 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.80 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |