C24H32O14 — CID 134931315
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(1R,2R,6R,7S)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-10-yl]methyl]oxan-2-yl]methyl acetate (PubChem CID 134931315) has the molecular formula C24H32O14 and a molecular weight of 544.51 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(1R,2R,6R,7S)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-10-yl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(1R,2R,6R,7S)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-10-yl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134931315 |
| Molecular Formula | C24H32O14 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[[(1R,2R,6R,7S)-4,4-dimethyl-9-oxo-3,5,8,11-tetraoxatricyclo[5.3.1.02,6]undecan-10-yl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](CC2C(=O)O[C@@H]3O[C@H]2[C@H]2OC(C)(C)O[C@@H]32)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H32O14/c1-9(25)30-8-15-18(32-11(3)27)19(33-12(4)28)17(31-10(2)26)14(34-15)7-13-16-20-21(38-24(5,6)37-20)23(35-16)36-22(13)29/h13-21,23H,7-8H2,1-6H3/t13?,14-,15+,16+,17-,18+,19+,20+,21+,23-/m0/s1 |
| InChIKey | BMUHPENTQVJYDB-JLPOJRFXSA-N |
| XLogP | -0.08 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|