C20H32O9 — CID 134931360
ditert-butyl (2S,3R)-3-[(1R)-1-hydroxy-2-methoxy-2-oxoethyl]-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate (PubChem CID 134931360) has the molecular formula C20H32O9 and a molecular weight of 416.47 g/mol. Its IUPAC name is ditert-butyl (2S,3R)-3-[(1R)-1-hydroxy-2-methoxy-2-oxoethyl]-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate.
| Compound Name | ditert-butyl (2S,3R)-3-[(1R)-1-hydroxy-2-methoxy-2-oxoethyl]-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 134931360 |
| Molecular Formula | C20H32O9 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | ditert-butyl (2S,3R)-3-[(1R)-1-hydroxy-2-methoxy-2-oxoethyl]-1,4-dioxaspiro[4.4]nonane-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H](O)[C@@]1(C(=O)OC(C)(C)C)OC2(CCCC2)O[C@@H]1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32O9/c1-17(2,3)27-15(23)13-20(12(21)14(22)25-7,16(24)28-18(4,5)6)29-19(26-13)10-8-9-11-19/h12-13,21H,8-11H2,1-7H3/t12-,13+,20+/m0/s1 |
| InChIKey | RMFAEZZIIQFLJS-MRRFBWAASA-N |
| XLogP | 1.63 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|