C10H18O4S — CID 134931365
methyl (2S,3R)-3-ethylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate (PubChem CID 134931365) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is methyl (2S,3R)-3-ethylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate.
| Compound Name | methyl (2S,3R)-3-ethylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate |
|---|---|
| PubChem CID | 134931365 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | methyl (2S,3R)-3-ethylsulfanylcarbonyl-2-hydroxy-2-methylpentanoate |
| SMILES | CCSC(=O)[C@H](CC)[C@](C)(O)C(=O)OC |
| InChI | InChI=1S/C10H18O4S/c1-5-7(8(11)15-6-2)10(3,13)9(12)14-4/h7,13H,5-6H2,1-4H3/t7-,10-/m0/s1 |
| InChIKey | XDYCRHNVWLSVRW-XVKPBYJWSA-N |
| XLogP | 1.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|