C9H16O5S — CID 134931453
(3aR,5S,6R,6aR)-5-[(1R)-2-hydroxy-1-sulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 134931453) has the molecular formula C9H16O5S and a molecular weight of 236.29 g/mol. Its IUPAC name is (3aR,5S,6R,6aR)-5-[(1R)-2-hydroxy-1-sulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5S,6R,6aR)-5-[(1R)-2-hydroxy-1-sulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 134931453 |
| Molecular Formula | C9H16O5S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | (3aR,5S,6R,6aR)-5-[(1R)-2-hydroxy-1-sulfanylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H](S)CO)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C9H16O5S/c1-9(2)13-7-5(11)6(4(15)3-10)12-8(7)14-9/h4-8,10-11,15H,3H2,1-2H3/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | BPNZIVGVDSTTDT-OZRXBMAMSA-N |
| XLogP | -0.49 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|