About S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate
S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate (PubChem CID 134931467) has the molecular formula C13H28O3SSi
and a molecular weight of 292.52 g/mol. Its IUPAC name is S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate.
Molecular Properties
| Compound Name | S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate |
| PubChem CID | 134931467 |
| Molecular Formula | C13H28O3SSi |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate |
| SMILES | CCSC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CC |
| InChI | InChI=1S/C13H28O3SSi/c1-8-10(14)11(12(15)17-9-2)16-18(6,7)13(3,4)5/h10-11,14H,8-9H2,1-7H3/t10-,11-/m1/s1 |
| InChIKey | ZXUAUKXRPNNOAG-GHMZBOCLSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate?
The IUPAC name of S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate (CID 134931467) is S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate.
What is the SMILES notation for S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate?
The canonical SMILES for S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate is CCSC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CC.
What is the InChIKey of S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate?
The InChIKey is ZXUAUKXRPNNOAG-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H28O3SSi/c1-8-10(14)11(12(15)17-9-2)16-18(6,7)13(3,4)5/h10-11,14H,8-9H2,1-7H3/t10-,11-/m1/s1.
What are the key properties of S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate?
S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate has a molecular weight of 292.52 g/mol, XLogP of 3.43, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2R,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypentanethioate is sourced from PubChem (CID 134931467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).