C16H21NO3 — CID 134931490
(1S,2S)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbut-3-en-1-ol (PubChem CID 134931490) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (1S,2S)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbut-3-en-1-ol.
| Compound Name | (1S,2S)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 134931490 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (1S,2S)-1-[(4S,5S)-4-(methoxymethyl)-5-phenyl-4,5-dihydro-1,3-oxazol-2-yl]-2-methylbut-3-en-1-ol |
| SMILES | C=C[C@H](C)[C@H](O)C1=N[C@@H](COC)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C16H21NO3/c1-4-11(2)14(18)16-17-13(10-19-3)15(20-16)12-8-6-5-7-9-12/h4-9,11,13-15,18H,1,10H2,2-3H3/t11-,13-,14-,15-/m0/s1 |
| InChIKey | ZTMOWGPYSQOLBT-MXAVVETBSA-N |
| XLogP | 2.35 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|