C22H42O2Si — CID 134931506
(Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhex-5-en-2-ol (PubChem CID 134931506) has the molecular formula C22H42O2Si and a molecular weight of 366.66 g/mol. Its IUPAC name is (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhex-5-en-2-ol.
| Compound Name | (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhex-5-en-2-ol |
|---|---|
| PubChem CID | 134931506 |
| Molecular Formula | C22H42O2Si |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (Z)-6-[(3aS,7R,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]-2-methylhex-5-en-2-ol |
| SMILES | CC(C)(O)CC/C=C\[C@]12CCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCC2 |
| InChI | InChI=1S/C22H42O2Si/c1-20(2,3)25(6,7)24-19-13-11-17-22(16-10-12-18(19)22)15-9-8-14-21(4,5)23/h9,15,18-19,23H,8,10-14,16-17H2,1-7H3/b15-9-/t18-,19+,22-/m0/s1 |
| InChIKey | WIEQSINPZQRASR-CNAVDRRYSA-N |
| XLogP | 6.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|