C24H32F2O4Si — CID 134931614
[2,2-difluoro-1,3-bis[(4-methoxyphenyl)methoxymethyl]cyclopropyl]-trimethylsilane (PubChem CID 134931614) has the molecular formula C24H32F2O4Si and a molecular weight of 450.60 g/mol. Its IUPAC name is [2,2-difluoro-1,3-bis[(4-methoxyphenyl)methoxymethyl]cyclopropyl]-trimethylsilane.
| Compound Name | [2,2-difluoro-1,3-bis[(4-methoxyphenyl)methoxymethyl]cyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 134931614 |
| Molecular Formula | C24H32F2O4Si |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [2,2-difluoro-1,3-bis[(4-methoxyphenyl)methoxymethyl]cyclopropyl]-trimethylsilane |
| SMILES | COc1ccc(COCC2C(F)(F)C2(COCc2ccc(OC)cc2)[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C24H32F2O4Si/c1-27-20-10-6-18(7-11-20)14-29-16-22-23(24(22,25)26,31(3,4)5)17-30-15-19-8-12-21(28-2)13-9-19/h6-13,22H,14-17H2,1-5H3 |
| InChIKey | VMGWEDNQJPIDDD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|