C14H32O3Si — CID 134931680
(2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylheptane-3,5-diol (PubChem CID 134931680) has the molecular formula C14H32O3Si and a molecular weight of 276.49 g/mol. Its IUPAC name is (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylheptane-3,5-diol.
| Compound Name | (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylheptane-3,5-diol |
|---|---|
| PubChem CID | 134931680 |
| Molecular Formula | C14H32O3Si |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (2S,3S,5R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylheptane-3,5-diol |
| SMILES | CC[C@@H](O)C[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32O3Si/c1-8-12(15)9-13(16)11(2)10-17-18(6,7)14(3,4)5/h11-13,15-16H,8-10H2,1-7H3/t11-,12+,13-/m0/s1 |
| InChIKey | GHKGIFDLSPNXCS-XQQFMLRXSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|