C35H43NO6 — CID 134931794
N-[(2R,3R,4R,5R,6R)-2-(1-hydroxycyclohexyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide (PubChem CID 134931794) has the molecular formula C35H43NO6 and a molecular weight of 573.73 g/mol. Its IUPAC name is N-[(2R,3R,4R,5R,6R)-2-(1-hydroxycyclohexyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5R,6R)-2-(1-hydroxycyclohexyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 134931794 |
| Molecular Formula | C35H43NO6 |
| Molecular Weight | 573.73 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | N-[(2R,3R,4R,5R,6R)-2-(1-hydroxycyclohexyl)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H]1C1(O)CCCCC1 |
| InChI | InChI=1S/C35H43NO6/c1-26(37)36-31-33(41-24-29-18-10-4-11-19-29)32(40-23-28-16-8-3-9-17-28)30(25-39-22-27-14-6-2-7-15-27)42-34(31)35(38)20-12-5-13-21-35/h2-4,6-11,14-19,30-34,38H,5,12-13,20-25H2,1H3,(H,36,37)/t30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | NKTTUPRFPRGVRA-BGSSSCFASA-N |
| XLogP | 5.34 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |