C12H18O5 — CID 134931824
ethyl 3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]propanoate (PubChem CID 134931824) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is ethyl 3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]propanoate.
| Compound Name | ethyl 3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]propanoate |
|---|---|
| PubChem CID | 134931824 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | ethyl 3-[(3S,6R)-3-acetyloxy-3,6-dihydro-2H-pyran-6-yl]propanoate |
| SMILES | CCOC(=O)CC[C@@H]1C=C[C@H](OC(C)=O)CO1 |
| InChI | InChI=1S/C12H18O5/c1-3-15-12(14)7-6-10-4-5-11(8-16-10)17-9(2)13/h4-5,10-11H,3,6-8H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | HGIABMSLHJRCHY-QWRGUYRKSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|