C13H19F3O3S — CID 134932014
[(4aS,8aR)-4a,8a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 134932014) has the molecular formula C13H19F3O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is [(4aS,8aR)-4a,8a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(4aS,8aR)-4a,8a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134932014 |
| Molecular Formula | C13H19F3O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | [(4aS,8aR)-4a,8a-dimethyl-3,4,5,6,7,8-hexahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | C[C@@]12CCCC[C@]1(C)C=C(OS(=O)(=O)C(F)(F)F)CC2 |
| InChI | InChI=1S/C13H19F3O3S/c1-11-6-3-4-7-12(11,2)9-10(5-8-11)19-20(17,18)13(14,15)16/h9H,3-8H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | SIIVMLVHZPPSCT-NWDGAFQWSA-N |
| XLogP | 4.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|