C15H18F3N — CID 134932049
1-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]piperidine (PubChem CID 134932049) has the molecular formula C15H18F3N and a molecular weight of 269.31 g/mol. Its IUPAC name is 1-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]piperidine.
| Compound Name | 1-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]piperidine |
|---|---|
| PubChem CID | 134932049 |
| Molecular Formula | C15H18F3N |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-[(Z)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]piperidine |
| SMILES | FC(F)(F)/C(=C/Cc1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C15H18F3N/c16-15(17,18)14(19-11-5-2-6-12-19)10-9-13-7-3-1-4-8-13/h1,3-4,7-8,10H,2,5-6,9,11-12H2/b14-10- |
| InChIKey | DHDDAOKRPZYKKY-UVTDQMKNSA-N |
| XLogP | 4.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |