C13H9F17S — CID 134932079
3-(1-tert-butylsulfanyl-1,2,2,2-tetrafluoroethyl)-1,1,1,4,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 134932079) has the molecular formula C13H9F17S and a molecular weight of 520.25 g/mol. Its IUPAC name is 3-(1-tert-butylsulfanyl-1,2,2,2-tetrafluoroethyl)-1,1,1,4,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | 3-(1-tert-butylsulfanyl-1,2,2,2-tetrafluoroethyl)-1,1,1,4,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 134932079 |
| Molecular Formula | C13H9F17S |
| Molecular Weight | 520.25 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 3-(1-tert-butylsulfanyl-1,2,2,2-tetrafluoroethyl)-1,1,1,4,5,5,5-heptafluoro-2,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | CC(C)(C)SC(F)(C(=C(C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H9F17S/c1-6(2,3)31-8(15,13(28,29)30)4(5(9(16,17)18)10(19,20)21)7(14,11(22,23)24)12(25,26)27/h1-3H3 |
| InChIKey | ZYDOVEPETNLZCC-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.25 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|