About 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane
1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane (PubChem CID 134932161) has the molecular formula C19H32F2
and a molecular weight of 298.46 g/mol. Its IUPAC name is 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane |
| PubChem CID | 134932161 |
| Molecular Formula | C19H32F2 |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane |
| SMILES | CCCCC1CCC(C2CCC(C/C(F)=C/F)CC2)CC1 |
| InChI | InChI=1S/C19H32F2/c1-2-3-4-15-5-9-17(10-6-15)18-11-7-16(8-12-18)13-19(21)14-20/h14-18H,2-13H2,1H3/b19-14- |
| InChIKey | OFZXFSPAGZFIJY-RGEXLXHISA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane?
The IUPAC name of 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane (CID 134932161) is 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane.
What is the SMILES notation for 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane?
The canonical SMILES for 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane is CCCCC1CCC(C2CCC(C/C(F)=C/F)CC2)CC1.
What is the InChIKey of 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane?
The InChIKey is OFZXFSPAGZFIJY-RGEXLXHISA-N. The full InChI is InChI=1S/C19H32F2/c1-2-3-4-15-5-9-17(10-6-15)18-11-7-16(8-12-18)13-19(21)14-20/h14-18H,2-13H2,1H3/b19-14-.
What are the key properties of 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane?
1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane has a molecular weight of 298.46 g/mol, XLogP of 6.96, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-[4-[(Z)-2,3-difluoroprop-2-enyl]cyclohexyl]cyclohexane is sourced from PubChem (CID 134932161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).