C16H15Cl4NO4S — CID 134932165
(1S,2S,6R,7S)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-phenyl-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide (PubChem CID 134932165) has the molecular formula C16H15Cl4NO4S and a molecular weight of 459.18 g/mol. Its IUPAC name is (1S,2S,6R,7S)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-phenyl-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide.
| Compound Name | (1S,2S,6R,7S)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-phenyl-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide |
|---|---|
| PubChem CID | 134932165 |
| Molecular Formula | C16H15Cl4NO4S |
| Molecular Weight | 459.18 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | (1S,2S,6R,7S)-1,7,8,9-tetrachloro-10,10-dimethoxy-4-phenyl-3λ6-thia-4-azatricyclo[5.2.1.02,6]dec-8-ene 3,3-dioxide |
| SMILES | COC1(OC)[C@@]2(Cl)C(Cl)=C(Cl)[C@]1(Cl)[C@@H]1CN(c3ccccc3)S(=O)(=O)[C@@H]12 |
| InChI | InChI=1S/C16H15Cl4NO4S/c1-24-16(25-2)14(19)10-8-21(9-6-4-3-5-7-9)26(22,23)13(10)15(16,20)12(18)11(14)17/h3-7,10,13H,8H2,1-2H3/t10-,13+,14-,15-/m1/s1 |
| InChIKey | AFWWBCWHEAIQAW-AQNFWKISSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|