C12H12S2 — CID 134932283
(2R,10R)-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene (PubChem CID 134932283) has the molecular formula C12H12S2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (2R,10R)-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene.
| Compound Name | (2R,10R)-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene |
|---|---|
| PubChem CID | 134932283 |
| Molecular Formula | C12H12S2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (2R,10R)-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene |
| SMILES | C1=CC2C(=CS[C@@H]3C4C=CC(C4)[C@H]23)S1 |
| InChI | InChI=1S/C12H12S2/c1-2-8-5-7(1)11-9-3-4-13-10(9)6-14-12(8)11/h1-4,6-9,11-12H,5H2/t7?,8?,9?,11-,12-/m1/s1 |
| InChIKey | IYDOTVDFADPKJZ-PWZSAFAFSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|