C26H49IO5Si — CID 134932345
[(4S,5S,6R,7R)-7-butyl-6-[(E)-3-iodo-2-methylprop-2-enyl]-4-methyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134932345) has the molecular formula C26H49IO5Si and a molecular weight of 596.66 g/mol. Its IUPAC name is [(4S,5S,6R,7R)-7-butyl-6-[(E)-3-iodo-2-methylprop-2-enyl]-4-methyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(4S,5S,6R,7R)-7-butyl-6-[(E)-3-iodo-2-methylprop-2-enyl]-4-methyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134932345 |
| Molecular Formula | C26H49IO5Si |
| Molecular Weight | 596.66 g/mol |
| Exact Mass | 596.24 |
| IUPAC Name | [(4S,5S,6R,7R)-7-butyl-6-[(E)-3-iodo-2-methylprop-2-enyl]-4-methyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCC[C@H]1OCO[C@@](C)(COC(=O)C(C)(C)C)[C@@H](O[Si](CC)(CC)CC)[C@@H]1C/C(C)=C/I |
| InChI | InChI=1S/C26H49IO5Si/c1-10-14-15-22-21(16-20(5)17-27)23(32-33(11-2,12-3)13-4)26(9,31-19-30-22)18-29-24(28)25(6,7)8/h17,21-23H,10-16,18-19H2,1-9H3/b20-17+/t21-,22-,23+,26+/m1/s1 |
| InChIKey | FPJQRUWKNKGDFN-RCDMAQPOSA-N |
| XLogP | 7.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.66 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|