C11H5F17S — CID 134932392
(E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methylsulfanyldec-1-ene (PubChem CID 134932392) has the molecular formula C11H5F17S and a molecular weight of 492.19 g/mol. Its IUPAC name is (E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methylsulfanyldec-1-ene.
| Compound Name | (E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methylsulfanyldec-1-ene |
|---|---|
| PubChem CID | 134932392 |
| Molecular Formula | C11H5F17S |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | (E)-3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-1-methylsulfanyldec-1-ene |
| SMILES | CS/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F17S/c1-29-3-2-4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h2-3H,1H3/b3-2+ |
| InChIKey | XHIWPAOBDGVLCN-NSCUHMNNSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|