C19H23F3O3 — CID 134932444
(4E,6E)-1-[(2-methylpropan-2-yl)oxy]-7-phenyl-1-(2,2,2-trifluoroethoxy)hepta-4,6-dien-3-one (PubChem CID 134932444) has the molecular formula C19H23F3O3 and a molecular weight of 356.38 g/mol. Its IUPAC name is (4E,6E)-1-[(2-methylpropan-2-yl)oxy]-7-phenyl-1-(2,2,2-trifluoroethoxy)hepta-4,6-dien-3-one.
| Compound Name | (4E,6E)-1-[(2-methylpropan-2-yl)oxy]-7-phenyl-1-(2,2,2-trifluoroethoxy)hepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 134932444 |
| Molecular Formula | C19H23F3O3 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (4E,6E)-1-[(2-methylpropan-2-yl)oxy]-7-phenyl-1-(2,2,2-trifluoroethoxy)hepta-4,6-dien-3-one |
| SMILES | CC(C)(C)OC(CC(=O)/C=C/C=C/c1ccccc1)OCC(F)(F)F |
| InChI | InChI=1S/C19H23F3O3/c1-18(2,3)25-17(24-14-19(20,21)22)13-16(23)12-8-7-11-15-9-5-4-6-10-15/h4-12,17H,13-14H2,1-3H3/b11-7+,12-8+ |
| InChIKey | WJHDPLMKXGAXQC-MKICQXMISA-N |
| XLogP | 4.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|