About (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine
(1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine (PubChem CID 134932567) has the molecular formula C14H24NO2P
and a molecular weight of 269.32 g/mol. Its IUPAC name is (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine |
| PubChem CID | 134932567 |
| Molecular Formula | C14H24NO2P |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine |
| SMILES | CCOP(OCC)c1ccccc1[C@@H](C)N(C)C |
| InChI | InChI=1S/C14H24NO2P/c1-6-16-18(17-7-2)14-11-9-8-10-13(14)12(3)15(4)5/h8-12H,6-7H2,1-5H3/t12-/m1/s1 |
| InChIKey | RTCJVKPPOAGVBN-GFCCVEGCSA-N |
| XLogP | 3.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine?
The IUPAC name of (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine (CID 134932567) is (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine.
What is the SMILES notation for (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine?
The canonical SMILES for (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine is CCOP(OCC)c1ccccc1[C@@H](C)N(C)C.
What is the InChIKey of (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine?
The InChIKey is RTCJVKPPOAGVBN-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H24NO2P/c1-6-16-18(17-7-2)14-11-9-8-10-13(14)12(3)15(4)5/h8-12H,6-7H2,1-5H3/t12-/m1/s1.
What are the key properties of (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine?
(1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine has a molecular weight of 269.32 g/mol, XLogP of 3.32, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2-diethoxyphosphanylphenyl)-N,N-dimethylethanamine is sourced from PubChem (CID 134932567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).