C24H36O3 — CID 134932850
1-[(8'R,9'S,10'R,13'S,14'S,17'S)-10',13',17'-trimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone (PubChem CID 134932850) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 1-[(8'R,9'S,10'R,13'S,14'S,17'S)-10',13',17'-trimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone.
| Compound Name | 1-[(8'R,9'S,10'R,13'S,14'S,17'S)-10',13',17'-trimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
|---|---|
| PubChem CID | 134932850 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-[(8'R,9'S,10'R,13'S,14'S,17'S)-10',13',17'-trimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene]-17'-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CC[C@H]2[C@@H]3CC=C4CC5(CC[C@]4(C)[C@H]3CC[C@@]21C)OCCO5 |
| InChI | InChI=1S/C24H36O3/c1-16(25)22(3)9-8-20-18-6-5-17-15-24(26-13-14-27-24)12-11-21(17,2)19(18)7-10-23(20,22)4/h5,18-20H,6-15H2,1-4H3/t18-,19+,20+,21+,22-,23+/m1/s1 |
| InChIKey | BELOXSVUYOREQG-AERYXGCMSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|