C8H14O2S — CID 134932965
(3R,5S,7Z)-5-methoxy-3,4,5,6-tetrahydro-2H-thiocin-3-ol (PubChem CID 134932965) has the molecular formula C8H14O2S and a molecular weight of 174.26 g/mol. Its IUPAC name is (3R,5S,7Z)-5-methoxy-3,4,5,6-tetrahydro-2H-thiocin-3-ol.
| Compound Name | (3R,5S,7Z)-5-methoxy-3,4,5,6-tetrahydro-2H-thiocin-3-ol |
|---|---|
| PubChem CID | 134932965 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (3R,5S,7Z)-5-methoxy-3,4,5,6-tetrahydro-2H-thiocin-3-ol |
| SMILES | CO[C@H]1C/C=C\SC[C@H](O)C1 |
| InChI | InChI=1S/C8H14O2S/c1-10-8-3-2-4-11-6-7(9)5-8/h2,4,7-9H,3,5-6H2,1H3/b4-2-/t7-,8+/m1/s1 |
| InChIKey | MDQCHVBVCQVQQI-KTXBOUKSSA-N |
| XLogP | 1.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |