About (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol
(Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol (PubChem CID 134932971) has the molecular formula C17H18OS
and a molecular weight of 270.40 g/mol. Its IUPAC name is (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol.
Molecular Properties
| Compound Name | (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol |
| PubChem CID | 134932971 |
| Molecular Formula | C17H18OS |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol |
| SMILES | OC(CCc1ccccc1)/C(S)=C/c1ccccc1 |
| InChI | InChI=1S/C17H18OS/c18-16(12-11-14-7-3-1-4-8-14)17(19)13-15-9-5-2-6-10-15/h1-10,13,16,18-19H,11-12H2/b17-13- |
| InChIKey | CHKMSDJLZOLQIA-LGMDPLHJSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol?
The IUPAC name of (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol (CID 134932971) is (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol.
What is the SMILES notation for (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol?
The canonical SMILES for (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol is OC(CCc1ccccc1)/C(S)=C/c1ccccc1.
What is the InChIKey of (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol?
The InChIKey is CHKMSDJLZOLQIA-LGMDPLHJSA-N. The full InChI is InChI=1S/C17H18OS/c18-16(12-11-14-7-3-1-4-8-14)17(19)13-15-9-5-2-6-10-15/h1-10,13,16,18-19H,11-12H2/b17-13-.
What are the key properties of (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol?
(Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol has a molecular weight of 270.40 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,5-diphenyl-2-sulfanylpent-1-en-3-ol is sourced from PubChem (CID 134932971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).