About 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane
1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane (PubChem CID 134932978) has the molecular formula C20H34F2
and a molecular weight of 312.49 g/mol. Its IUPAC name is 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane.
Molecular Properties
| Compound Name | 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane |
| PubChem CID | 134932978 |
| Molecular Formula | C20H34F2 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane |
| SMILES | CCCCC1CCC(C2CCC(CC/C(F)=C\F)CC2)CC1 |
| InChI | InChI=1S/C20H34F2/c1-2-3-4-16-5-10-18(11-6-16)19-12-7-17(8-13-19)9-14-20(22)15-21/h15-19H,2-14H2,1H3/b20-15+ |
| InChIKey | MPNACNIBGDYKSF-HMMYKYKNSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane?
The IUPAC name of 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane (CID 134932978) is 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane.
What is the SMILES notation for 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane?
The canonical SMILES for 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane is CCCCC1CCC(C2CCC(CC/C(F)=C\F)CC2)CC1.
What is the InChIKey of 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane?
The InChIKey is MPNACNIBGDYKSF-HMMYKYKNSA-N. The full InChI is InChI=1S/C20H34F2/c1-2-3-4-16-5-10-18(11-6-16)19-12-7-17(8-13-19)9-14-20(22)15-21/h15-19H,2-14H2,1H3/b20-15+.
What are the key properties of 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane?
1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane has a molecular weight of 312.49 g/mol, XLogP of 7.35, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-4-[4-[(E)-3,4-difluorobut-3-enyl]cyclohexyl]cyclohexane is sourced from PubChem (CID 134932978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).