C14H8Cl7NO2 — CID 134932984
(2S,3S,6S)-2,3,4,5,6,7,8-heptachloro-2-(pyrrolidine-1-carbonyl)tricyclo[4.3.0.01,3]nona-4,7-dien-9-one (PubChem CID 134932984) has the molecular formula C14H8Cl7NO2 and a molecular weight of 470.39 g/mol. Its IUPAC name is (2S,3S,6S)-2,3,4,5,6,7,8-heptachloro-2-(pyrrolidine-1-carbonyl)tricyclo[4.3.0.01,3]nona-4,7-dien-9-one.
| Compound Name | (2S,3S,6S)-2,3,4,5,6,7,8-heptachloro-2-(pyrrolidine-1-carbonyl)tricyclo[4.3.0.01,3]nona-4,7-dien-9-one |
|---|---|
| PubChem CID | 134932984 |
| Molecular Formula | C14H8Cl7NO2 |
| Molecular Weight | 470.39 g/mol |
| Exact Mass | 466.84 |
| IUPAC Name | (2S,3S,6S)-2,3,4,5,6,7,8-heptachloro-2-(pyrrolidine-1-carbonyl)tricyclo[4.3.0.01,3]nona-4,7-dien-9-one |
| SMILES | O=C1C(Cl)=C(Cl)[C@]2(Cl)C(Cl)=C(Cl)[C@]3(Cl)C12[C@]3(Cl)C(=O)N1CCCC1 |
| InChI | InChI=1S/C14H8Cl7NO2/c15-5-6(16)11(19)7(17)8(18)13(20)12(11,9(5)23)14(13,21)10(24)22-3-1-2-4-22/h1-4H2/t11-,12?,13-,14+/m0/s1 |
| InChIKey | SZGIRIRZBFXVRA-FUDCBSFHSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|