C23H35IO4Si — CID 134933031
[(2S,4aS,6R,7S,9aR)-6-[(Z)-2-iodoethenyl]-4a-methyl-2-phenyl-4,6,7,8,9,9a-hexahydro-[1,3]dioxino[5,4-b]oxepin-7-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 134933031) has the molecular formula C23H35IO4Si and a molecular weight of 530.52 g/mol. Its IUPAC name is [(2S,4aS,6R,7S,9aR)-6-[(Z)-2-iodoethenyl]-4a-methyl-2-phenyl-4,6,7,8,9,9a-hexahydro-[1,3]dioxino[5,4-b]oxepin-7-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4aS,6R,7S,9aR)-6-[(Z)-2-iodoethenyl]-4a-methyl-2-phenyl-4,6,7,8,9,9a-hexahydro-[1,3]dioxino[5,4-b]oxepin-7-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134933031 |
| Molecular Formula | C23H35IO4Si |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | [(2S,4aS,6R,7S,9aR)-6-[(Z)-2-iodoethenyl]-4a-methyl-2-phenyl-4,6,7,8,9,9a-hexahydro-[1,3]dioxino[5,4-b]oxepin-7-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2O[C@@H](c3ccccc3)OC[C@]2(C)O[C@@H]1/C=C\I |
| InChI | InChI=1S/C23H35IO4Si/c1-22(2,3)29(5,6)28-19-12-13-20-23(4,27-18(19)14-15-24)16-25-21(26-20)17-10-8-7-9-11-17/h7-11,14-15,18-21H,12-13,16H2,1-6H3/b15-14-/t18-,19+,20-,21+,23+/m1/s1 |
| InChIKey | KRHLYAWGOCPXBC-IQMDXGIXSA-N |
| XLogP | 6.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|