C14H16F3NO — CID 134933046
4-[(E)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]morpholine (PubChem CID 134933046) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is 4-[(E)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]morpholine.
| Compound Name | 4-[(E)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]morpholine |
|---|---|
| PubChem CID | 134933046 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-[(E)-1,1,1-trifluoro-4-phenylbut-2-en-2-yl]morpholine |
| SMILES | FC(F)(F)/C(=C\Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C14H16F3NO/c15-14(16,17)13(18-8-10-19-11-9-18)7-6-12-4-2-1-3-5-12/h1-5,7H,6,8-11H2/b13-7+ |
| InChIKey | HCIDRJTVUFCVRW-NTUHNPAUSA-N |
| XLogP | 3.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |