C39H35F7O6 — CID 134933072
(E)-3,4,5,5,6,6,6-heptafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hex-3-en-2-one (PubChem CID 134933072) has the molecular formula C39H35F7O6 and a molecular weight of 732.69 g/mol. Its IUPAC name is (E)-3,4,5,5,6,6,6-heptafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hex-3-en-2-one.
| Compound Name | (E)-3,4,5,5,6,6,6-heptafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hex-3-en-2-one |
|---|---|
| PubChem CID | 134933072 |
| Molecular Formula | C39H35F7O6 |
| Molecular Weight | 732.69 g/mol |
| Exact Mass | 732.23 |
| IUPAC Name | (E)-3,4,5,5,6,6,6-heptafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hex-3-en-2-one |
| SMILES | O=C(C[C@@H]1O[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)/C(F)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C39H35F7O6/c40-32(36(41)38(42,43)39(44,45)46)30(47)21-31-33(48-22-26-13-5-1-6-14-26)34(49-23-27-15-7-2-8-16-27)35(50-24-28-17-9-3-10-18-28)37(52-31)51-25-29-19-11-4-12-20-29/h1-20,31,33-35,37H,21-25H2/b36-32+/t31-,33-,34+,35-,37-/m0/s1 |
| InChIKey | TURHYZCRNTYZPG-JZFVEUGTSA-N |
| XLogP | 8.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.69 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|