C39H36F8O6 — CID 134933073
3,4,4,5,5,6,6,6-octafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hexan-2-one (PubChem CID 134933073) has the molecular formula C39H36F8O6 and a molecular weight of 752.70 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,6-octafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hexan-2-one.
| Compound Name | 3,4,4,5,5,6,6,6-octafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hexan-2-one |
|---|---|
| PubChem CID | 134933073 |
| Molecular Formula | C39H36F8O6 |
| Molecular Weight | 752.70 g/mol |
| Exact Mass | 752.24 |
| IUPAC Name | 3,4,4,5,5,6,6,6-octafluoro-1-[(2S,3S,4R,5S,6S)-3,4,5,6-tetrakis(phenylmethoxy)oxan-2-yl]hexan-2-one |
| SMILES | O=C(C[C@@H]1O[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C39H36F8O6/c40-35(37(41,42)38(43,44)39(45,46)47)30(48)21-31-32(49-22-26-13-5-1-6-14-26)33(50-23-27-15-7-2-8-16-27)34(51-24-28-17-9-3-10-18-28)36(53-31)52-25-29-19-11-4-12-20-29/h1-20,31-36H,21-25H2/t31-,32-,33+,34-,35?,36-/m0/s1 |
| InChIKey | AIDKDSNSEGENBF-HHSFPHPRSA-N |
| XLogP | 8.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.70 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|