C21H16BrN2O2P — CID 134933123
3-(4-bromophenyl)-4-hydroxy-1,6-diphenyl-1,2,4λ5-diazaphosphinine 4-oxide (PubChem CID 134933123) has the molecular formula C21H16BrN2O2P and a molecular weight of 439.25 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4-hydroxy-1,6-diphenyl-1,2,4λ5-diazaphosphinine 4-oxide.
| Compound Name | 3-(4-bromophenyl)-4-hydroxy-1,6-diphenyl-1,2,4λ5-diazaphosphinine 4-oxide |
|---|---|
| PubChem CID | 134933123 |
| Molecular Formula | C21H16BrN2O2P |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 438.01 |
| IUPAC Name | 3-(4-bromophenyl)-4-hydroxy-1,6-diphenyl-1,2,4λ5-diazaphosphinine 4-oxide |
| SMILES | O=P1(O)C=C(c2ccccc2)N(c2ccccc2)N=C1c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H16BrN2O2P/c22-18-13-11-17(12-14-18)21-23-24(19-9-5-2-6-10-19)20(15-27(21,25)26)16-7-3-1-4-8-16/h1-15H,(H,25,26) |
| InChIKey | QCOIPQNQNVFRDL-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|