C12H17F3O3S — CID 134933198
[(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 134933198) has the molecular formula C12H17F3O3S and a molecular weight of 298.33 g/mol. Its IUPAC name is [(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134933198 |
| Molecular Formula | C12H17F3O3S |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | [(4aS,8aS)-4a-methyl-4,5,6,7,8,8a-hexahydro-1H-naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12CC=C(OS(=O)(=O)C(F)(F)F)C[C@@H]1CCCC2 |
| InChI | InChI=1S/C12H17F3O3S/c1-11-6-3-2-4-9(11)8-10(5-7-11)18-19(16,17)12(13,14)15/h5,9H,2-4,6-8H2,1H3/t9-,11-/m0/s1 |
| InChIKey | VWLQCUXKIHNYMT-ONGXEEELSA-N |
| XLogP | 3.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|