About 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile
4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile (PubChem CID 134933229) has the molecular formula C11H10N2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile |
| PubChem CID | 134933229 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile |
| SMILES | C=C/C=C(\N)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H10N2/c1-2-3-11(13)10-6-4-9(8-12)5-7-10/h2-7H,1,13H2/b11-3- |
| InChIKey | NNFKJZBSPZRSFW-JYOAFUTRSA-N |
| XLogP | 2.04 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile?
The IUPAC name of 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile (CID 134933229) is 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile.
What is the SMILES notation for 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile?
The canonical SMILES for 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile is C=C/C=C(\N)c1ccc(C#N)cc1.
What is the InChIKey of 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile?
The InChIKey is NNFKJZBSPZRSFW-JYOAFUTRSA-N. The full InChI is InChI=1S/C11H10N2/c1-2-3-11(13)10-6-4-9(8-12)5-7-10/h2-7H,1,13H2/b11-3-.
What are the key properties of 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile?
4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile has a molecular weight of 170.21 g/mol, XLogP of 2.04, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-1-aminobuta-1,3-dienyl]benzonitrile is sourced from PubChem (CID 134933229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).