C30H22Cl2 — CID 134933549
[(3Z,4E)-3,4-bis(chloromethylidene)-1,2,2-triphenylcyclobutyl]benzene (PubChem CID 134933549) has the molecular formula C30H22Cl2 and a molecular weight of 453.41 g/mol. Its IUPAC name is [(3Z,4E)-3,4-bis(chloromethylidene)-1,2,2-triphenylcyclobutyl]benzene.
| Compound Name | [(3Z,4E)-3,4-bis(chloromethylidene)-1,2,2-triphenylcyclobutyl]benzene |
|---|---|
| PubChem CID | 134933549 |
| Molecular Formula | C30H22Cl2 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | [(3Z,4E)-3,4-bis(chloromethylidene)-1,2,2-triphenylcyclobutyl]benzene |
| SMILES | Cl/C=C1C(=C\Cl)\C(c2ccccc2)(c2ccccc2)C\1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H22Cl2/c31-21-27-28(22-32)30(25-17-9-3-10-18-25,26-19-11-4-12-20-26)29(27,23-13-5-1-6-14-23)24-15-7-2-8-16-24/h1-22H/b27-21-,28-22+ |
| InChIKey | UWFHTFCKIUKCDA-KKTFQPMKSA-N |
| XLogP | 8.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |