C13H14S2 — CID 134933562
(2R,10R)-8-methyl-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene (PubChem CID 134933562) has the molecular formula C13H14S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (2R,10R)-8-methyl-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene.
| Compound Name | (2R,10R)-8-methyl-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene |
|---|---|
| PubChem CID | 134933562 |
| Molecular Formula | C13H14S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | (2R,10R)-8-methyl-6,9-dithiatetracyclo[9.2.1.02,10.03,7]tetradeca-4,7,12-triene |
| SMILES | CC1=C2SC=CC2[C@H]2C3C=CC(C3)[C@H]2S1 |
| InChI | InChI=1S/C13H14S2/c1-7-12-10(4-5-14-12)11-8-2-3-9(6-8)13(11)15-7/h2-5,8-11,13H,6H2,1H3/t8?,9?,10?,11-,13-/m1/s1 |
| InChIKey | ZUOHMXCTBWNOHZ-BNKILJLVSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|