C23H24FNO7 — CID 134933780
[(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-methoxyoxan-2-yl]methyl benzoate (PubChem CID 134933780) has the molecular formula C23H24FNO7 and a molecular weight of 445.44 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-methoxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-methoxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 134933780 |
| Molecular Formula | C23H24FNO7 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-acetamido-4-benzoyloxy-3-fluoro-6-methoxyoxan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](F)[C@H](OC(=O)c2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C23H24FNO7/c1-14(26)25-19-20(32-22(28)16-11-7-4-8-12-16)18(24)17(31-23(19)29-2)13-30-21(27)15-9-5-3-6-10-15/h3-12,17-20,23H,13H2,1-2H3,(H,25,26)/t17-,18-,19-,20+,23+/m1/s1 |
| InChIKey | IKNLSIDYIIBHDD-PXUBBOAPSA-N |
| XLogP | 2.28 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |