About 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium
3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium (PubChem CID 134934258) has the molecular formula C11H21S+
and a molecular weight of 185.36 g/mol. Its IUPAC name is 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium.
Molecular Properties
| Compound Name | 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium |
| PubChem CID | 134934258 |
| Molecular Formula | C11H21S+ |
| Molecular Weight | 185.36 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium |
| SMILES | CC1=C(C(C)(C)C)C(C)(C)[S+]1C |
| InChI | InChI=1S/C11H21S/c1-8-9(10(2,3)4)11(5,6)12(8)7/h1-7H3/q+1 |
| InChIKey | JETXTJGEOGRLMI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium?
The IUPAC name of 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium (CID 134934258) is 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium.
What is the SMILES notation for 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium?
The canonical SMILES for 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium is CC1=C(C(C)(C)C)C(C)(C)[S+]1C.
What is the InChIKey of 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium?
The InChIKey is JETXTJGEOGRLMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21S/c1-8-9(10(2,3)4)11(5,6)12(8)7/h1-7H3/q+1.
What are the key properties of 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium?
3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium has a molecular weight of 185.36 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,2,2,4-tetramethylthiet-1-ium is sourced from PubChem (CID 134934258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).