About S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate
S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate (PubChem CID 134934326) has the molecular formula C8H15ClO2S
and a molecular weight of 210.73 g/mol. Its IUPAC name is S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate.
Molecular Properties
| Compound Name | S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate |
| PubChem CID | 134934326 |
| Molecular Formula | C8H15ClO2S |
| Molecular Weight | 210.73 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate |
| SMILES | CC(=O)SC[C@@H](Cl)COC(C)C |
| InChI | InChI=1S/C8H15ClO2S/c1-6(2)11-4-8(9)5-12-7(3)10/h6,8H,4-5H2,1-3H3/t8-/m0/s1 |
| InChIKey | MCFAPWISBDKCNK-QMMMGPOBSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.73 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate?
The IUPAC name of S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate (CID 134934326) is S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate.
What is the SMILES notation for S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate?
The canonical SMILES for S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate is CC(=O)SC[C@@H](Cl)COC(C)C.
What is the InChIKey of S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate?
The InChIKey is MCFAPWISBDKCNK-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H15ClO2S/c1-6(2)11-4-8(9)5-12-7(3)10/h6,8H,4-5H2,1-3H3/t8-/m0/s1.
What are the key properties of S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate?
S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate has a molecular weight of 210.73 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2S)-2-chloro-3-propan-2-yloxypropyl] ethanethioate is sourced from PubChem (CID 134934326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).