About 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene
5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene (PubChem CID 134934342) has the molecular formula C8H10S2
and a molecular weight of 170.30 g/mol. Its IUPAC name is 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene |
| PubChem CID | 134934342 |
| Molecular Formula | C8H10S2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.02 |
| IUPAC Name | 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene |
| SMILES | C1=C(C2=CCCS2)SCC1 |
| InChI | InChI=1S/C8H10S2/c1-3-7(9-5-1)8-4-2-6-10-8/h3-4H,1-2,5-6H2 |
| InChIKey | CYNKGHYAPSQENB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene?
The IUPAC name of 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene (CID 134934342) is 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene.
What is the SMILES notation for 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene?
The canonical SMILES for 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene is C1=C(C2=CCCS2)SCC1.
What is the InChIKey of 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene?
The InChIKey is CYNKGHYAPSQENB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S2/c1-3-7(9-5-1)8-4-2-6-10-8/h3-4H,1-2,5-6H2.
What are the key properties of 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene?
5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene has a molecular weight of 170.30 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,3-dihydrothiophen-5-yl)-2,3-dihydrothiophene is sourced from PubChem (CID 134934342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).