C15H17FO4 — CID 134934449
(3aR,4S,5S,6R,6aR)-6-fluoro-5-hydroxy-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 134934449) has the molecular formula C15H17FO4 and a molecular weight of 280.29 g/mol. Its IUPAC name is (3aR,4S,5S,6R,6aR)-6-fluoro-5-hydroxy-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5S,6R,6aR)-6-fluoro-5-hydroxy-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 134934449 |
| Molecular Formula | C15H17FO4 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (3aR,4S,5S,6R,6aR)-6-fluoro-5-hydroxy-4-(phenylmethoxymethyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](COCc3ccccc3)[C@H](O)[C@@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C15H17FO4/c16-13-14(18)11(10-6-12(17)20-15(10)13)8-19-7-9-4-2-1-3-5-9/h1-5,10-11,13-15,18H,6-8H2/t10-,11-,13-,14+,15-/m1/s1 |
| InChIKey | GUJBFSNQLZOWEM-SOMZYNEFSA-N |
| XLogP | 1.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |