About (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide
(2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide (PubChem CID 134934560) has the molecular formula C15H30INO2
and a molecular weight of 383.31 g/mol. Its IUPAC name is (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide.
Molecular Properties
| Compound Name | (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide |
| PubChem CID | 134934560 |
| Molecular Formula | C15H30INO2 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide |
| SMILES | CCCCCCC[C@H](O)[C@](C)(I)C(=O)N(CC)CC |
| InChI | InChI=1S/C15H30INO2/c1-5-8-9-10-11-12-13(18)15(4,16)14(19)17(6-2)7-3/h13,18H,5-12H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | XKFWLSRRGIBZRJ-ZFWWWQNUSA-N |
| XLogP | 3.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide?
The IUPAC name of (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide (CID 134934560) is (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide.
What is the SMILES notation for (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide?
The canonical SMILES for (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide is CCCCCCC[C@H](O)[C@](C)(I)C(=O)N(CC)CC.
What is the InChIKey of (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide?
The InChIKey is XKFWLSRRGIBZRJ-ZFWWWQNUSA-N. The full InChI is InChI=1S/C15H30INO2/c1-5-8-9-10-11-12-13(18)15(4,16)14(19)17(6-2)7-3/h13,18H,5-12H2,1-4H3/t13-,15-/m0/s1.
What are the key properties of (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide?
(2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide has a molecular weight of 383.31 g/mol, XLogP of 3.77, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-N,N-diethyl-3-hydroxy-2-iodo-2-methyldecanamide is sourced from PubChem (CID 134934560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).