C19H20NO3P — CID 134934636
N-(fluoren-9-ylidenemethyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 134934636) has the molecular formula C19H20NO3P and a molecular weight of 341.35 g/mol. Its IUPAC name is N-(fluoren-9-ylidenemethyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine.
| Compound Name | N-(fluoren-9-ylidenemethyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 134934636 |
| Molecular Formula | C19H20NO3P |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-(fluoren-9-ylidenemethyl)-5,5-dimethyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | CC1(C)COP(=O)(NC=C2c3ccccc3-c3ccccc32)OC1 |
| InChI | InChI=1S/C19H20NO3P/c1-19(2)12-22-24(21,23-13-19)20-11-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-11H,12-13H2,1-2H3,(H,20,21) |
| InChIKey | TVVMJOBBTKOVOU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|