C13H28N3O3P — CID 134934646
(Z)-N-[bis(dimethylamino)phosphoryl]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)but-1-en-1-amine (PubChem CID 134934646) has the molecular formula C13H28N3O3P and a molecular weight of 305.36 g/mol. Its IUPAC name is (Z)-N-[bis(dimethylamino)phosphoryl]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)but-1-en-1-amine.
| Compound Name | (Z)-N-[bis(dimethylamino)phosphoryl]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)but-1-en-1-amine |
|---|---|
| PubChem CID | 134934646 |
| Molecular Formula | C13H28N3O3P |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (Z)-N-[bis(dimethylamino)phosphoryl]-4-(2,2-dimethyl-1,3-dioxolan-4-yl)but-1-en-1-amine |
| SMILES | CN(C)P(=O)(N/C=C\CCC1COC(C)(C)O1)N(C)C |
| InChI | InChI=1S/C13H28N3O3P/c1-13(2)18-11-12(19-13)9-7-8-10-14-20(17,15(3)4)16(5)6/h8,10,12H,7,9,11H2,1-6H3,(H,14,17)/b10-8- |
| InChIKey | APYWHASCSNWXPG-NTMALXAHSA-N |
| XLogP | 2.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|